cas: 138374-00-2 — see every product listed under this CAS number, including other names
2-N-Boc-butane-1,2-diamine-HCl, 97%, 97% (CAS 138374-00-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1129OS-100mg |
| cas | 138374-00-2 |
| size | 100mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 366.80 Pln | |
| Chemat | 250mg | 534.80 Pln | |
| Chemat | 1g | 1240.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(1-aminobutan-2-yl)carbamate;hydrochloride (CAS 138374-00-2) is a chemical compound with the molecular formula C9H21ClN2O2 and a molecular weight of 224.73 g/mol. IUPAC name: tert-butyl N-(1-aminobutan-2-yl)carbamate;hydrochloride. InChIKey: SQWCEASKECSUOE-UHFFFAOYSA-N.
| Molecular formula | C9H21ClN2O2 |
|---|---|
| Molecular weight | 224.73 g/mol |
| IUPAC name | tert-butyl N-(1-aminobutan-2-yl)carbamate;hydrochloride |
| InChIKey | SQWCEASKECSUOE-UHFFFAOYSA-N |
| SMILES | CCC(CN)NC(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)