CAS 55528-53-5 appears in our catalog under these names: (S)-5-Amino-5-carboxy-N,N,N-trimethylpentan-1-aminium chloride, 95%, H-Lys(me)3-oh chloride, 95%, Nε,Nε,Nε-Trimethyllysine chloride, 98%, Nε,Nε,Nε-Trimethyllysine chloride, H–Lys(Me)₃–OH chloride. Offered by: BLDpharm, Combi-blocks, AmBeed, TargetMol, GLPBio. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 5mg, 1mg, 10mg.
[(5S)-5-amino-5-carboxypentyl]-trimethylazanium chloride (CAS 55528-53-5) is a chemical compound with the molecular formula C9H21ClN2O2 and a molecular weight of 224.73 g/mol. IUPAC name: [(5S)-5-amino-5-carboxypentyl]-trimethylazanium chloride. InChIKey: ZKIJKCHCMFGMCM-QRPNPIFTSA-N.
| Molecular formula | C9H21ClN2O2 |
|---|---|
| Molecular weight | 224.73 g/mol |
| IUPAC name | [(5S)-5-amino-5-carboxypentyl]-trimethylazanium chloride |
| InChIKey | ZKIJKCHCMFGMCM-QRPNPIFTSA-N |
| SMILES | C[N+](C)(C)CCCC[C@@H](C(=O)O)N.[Cl-] |
Computed by PubChem (NCBI)