Products 55528-53-5

CAS 55528-53-5 appears in our catalog under these names: H-Lys(me)3-oh chloride, 95%, Nε,Nε,Nε-Trimethyllysine chloride, 98%, Nε,Nε,Nε-Trimethyllysine chloride, H–Lys(Me)₃–OH chloride, Ne-(trimethyl)-L-lysine chloride. Offered by: Combi-blocks, AmBeed, TargetMol, GLPBio, Biosynth. Available pack sizes: 250mg, 5mg, 1mg, 10mg, 25mg, 50mg, 0,05g, 0,1g.

[(5S)-5-amino-5-carboxypentyl]-trimethylazanium chloride (CAS 55528-53-5) is a chemical compound with the molecular formula C9H21ClN2O2 and a molecular weight of 224.73 g/mol. IUPAC name: [(5S)-5-amino-5-carboxypentyl]-trimethylazanium chloride. InChIKey: ZKIJKCHCMFGMCM-QRPNPIFTSA-N.

Identity
Molecular formulaC9H21ClN2O2
Molecular weight224.73 g/mol
IUPAC name[(5S)-5-amino-5-carboxypentyl]-trimethylazanium chloride
InChIKeyZKIJKCHCMFGMCM-QRPNPIFTSA-N
SMILESC[N+](C)(C)CCCC[C@@H](C(=O)O)N.[Cl-]

Computed by PubChem (NCBI)