CAS 1188263-67-3 appears in our catalog under these names: tert–Butyl (3–aminopropyl)(methyl)carbamate hydrochloride, N-(3-Aminopropyl)-N-methylcarbamic Acid tert-Butyl Ester Hydrochloride, Boc,Me-DAP*HCl, Boc-N(Me)-(CH2)?-NH2·HCl 95%, tert-Butyl (3-aminopropyl)(methyl)carbamate hydrochloride, 95%, 95%. Offered by: GLPBio, TRC, Iris Biotech, Ambeed, Chemat. Available pack sizes: 10g, 1g, 5g, 500mg, 25g, 250mg.
Tert-butyl N-(3-aminopropyl)-N-methylcarbamate;hydrochloride (CAS 1188263-67-3) is a chemical compound with the molecular formula C9H21ClN2O2 and a molecular weight of 224.73 g/mol. IUPAC name: tert-butyl N-(3-aminopropyl)-N-methylcarbamate;hydrochloride. InChIKey: ZPISLPKNUNZUJQ-UHFFFAOYSA-N.
| Molecular formula | C9H21ClN2O2 |
|---|---|
| Molecular weight | 224.73 g/mol |
| IUPAC name | tert-butyl N-(3-aminopropyl)-N-methylcarbamate;hydrochloride |
| InChIKey | ZPISLPKNUNZUJQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)CCCN.Cl |
Computed by PubChem (NCBI)