CAS 169954-68-1 appears in our catalog under these names: 2-N-Boc-2-methylpropane-1,2-diamine hydrochloride, 95%, 2-N-Boc-2-Methylpropane-1,2-diamine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 5g.
Tert-butyl N-(1-amino-2-methylpropan-2-yl)carbamate;hydrochloride (CAS 169954-68-1) is a chemical compound with the molecular formula C9H21ClN2O2 and a molecular weight of 224.73 g/mol. IUPAC name: tert-butyl N-(1-amino-2-methylpropan-2-yl)carbamate;hydrochloride. InChIKey: JMLZLOMGUNTNJG-UHFFFAOYSA-N.
| Molecular formula | C9H21ClN2O2 |
|---|---|
| Molecular weight | 224.73 g/mol |
| IUPAC name | tert-butyl N-(1-amino-2-methylpropan-2-yl)carbamate;hydrochloride |
| InChIKey | JMLZLOMGUNTNJG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)CN.Cl |
Computed by PubChem (NCBI)