cas: 833486-94-5 — see every product listed under this CAS number, including other names
2-Nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline, 96%, 96% (CAS 833486-94-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115W6W-100mg |
| cas | 833486-94-5 |
| size | 100mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 338.00 Pln | |
| Chemat | 25g | 1206.80 Pln | |
| Chemat | 100g | 3122.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 833486-94-5) is a chemical compound with the molecular formula C12H17BN2O4 and a molecular weight of 264.09 g/mol. IUPAC name: 2-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: QOYJKGGBFKVKDP-UHFFFAOYSA-N.
| Molecular formula | C12H17BN2O4 |
|---|---|
| Molecular weight | 264.09 g/mol |
| IUPAC name | 2-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | QOYJKGGBFKVKDP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)