cas: 1184259-08-2 — see every product listed under this CAS number, including other names
2-Nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde 98% (CAS 1184259-08-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A883681-250mg |
| cas | 1184259-08-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1010.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A883681 |
2-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 1184259-08-2) is a chemical compound with the molecular formula C13H16BNO5 and a molecular weight of 277.08 g/mol. IUPAC name: 2-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: PQSNQQFRGFGLIV-UHFFFAOYSA-N.
| Molecular formula | C13H16BNO5 |
|---|---|
| Molecular weight | 277.08 g/mol |
| IUPAC name | 2-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | PQSNQQFRGFGLIV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)