Products 850593-02-1
CAS 850593-02-1 appears in our catalog under these names: 1-(4-Boronobenzoyl)piperidine-4-carboxylic acid, 98%, 1-(4-Boronobenzoyl)piperidine-4-carboxylic acid, 95%. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat. Available pack sizes: 5g, 25g, 100g, 1g, 250mg.
1-(4-boronobenzoyl)piperidine-4-carboxylic acid (CAS 850593-02-1) is a chemical compound with the molecular formula C13H16BNO5 and a molecular weight of 277.08 g/mol. IUPAC name: 1-(4-boronobenzoyl)piperidine-4-carboxylic acid. InChIKey: URCVWENBDSHRDE-UHFFFAOYSA-N.
| Molecular formula | C13H16BNO5 |
|---|---|
| Molecular weight | 277.08 g/mol |
| IUPAC name | 1-(4-boronobenzoyl)piperidine-4-carboxylic acid |
| InChIKey | URCVWENBDSHRDE-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)N2CCC(CC2)C(=O)O)(O)O |
Computed by PubChem (NCBI)