CAS 1184259-08-2 appears in our catalog under these names: 2-Nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde 98%, 2-Nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde, 98%, 3-Formyl-4-Nitrophenylboronic acid, pinacol ester, 98%, 3-Formyl-4-Nitrophenylboronic acid, pinacol ester, 98%, 98%. Offered by: Ambeed, Fluorochem, Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100g, 25g.
2-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 1184259-08-2) is a chemical compound with the molecular formula C13H16BNO5 and a molecular weight of 277.08 g/mol. IUPAC name: 2-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: PQSNQQFRGFGLIV-UHFFFAOYSA-N.
| Molecular formula | C13H16BNO5 |
|---|---|
| Molecular weight | 277.08 g/mol |
| IUPAC name | 2-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | PQSNQQFRGFGLIV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)