CAS 1256345-64-8 is the registry number for 1-Boc-Oxindole-5-boronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 100mg, 50mg.
[1-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxo-3H-indol-5-yl]boronic acid (CAS 1256345-64-8) is a chemical compound with the molecular formula C13H16BNO5 and a molecular weight of 277.08 g/mol. IUPAC name: [1-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxo-3H-indol-5-yl]boronic acid. InChIKey: UXXKKSRXRLPRCP-UHFFFAOYSA-N.
| Molecular formula | C13H16BNO5 |
|---|---|
| Molecular weight | 277.08 g/mol |
| IUPAC name | [1-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxo-3H-indol-5-yl]boronic acid |
| InChIKey | UXXKKSRXRLPRCP-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)N(C(=O)C2)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)