cas: 16090-33-8 — see every product listed under this CAS number, including other names
2-Nitrobenzene-1,4-diol 95% (CAS 16090-33-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A485826-25g |
| cas | 16090-33-8 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 2740.00 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 236.88 Pln | |
| Ambeed | 5g | 904.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A485826 |
2-nitrobenzene-1,4-diol (CAS 16090-33-8) is a chemical compound with the molecular formula C6H5NO4 and a molecular weight of 155.11 g/mol. IUPAC name: 2-nitrobenzene-1,4-diol. InChIKey: VIIYYMZOGKODQG-UHFFFAOYSA-N.
| Molecular formula | C6H5NO4 |
|---|---|
| Molecular weight | 155.11 g/mol |
| IUPAC name | 2-nitrobenzene-1,4-diol |
| InChIKey | VIIYYMZOGKODQG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)[N+](=O)[O-])O |
Computed by PubChem (NCBI)