cas: 1694-92-4 — see every product listed under this CAS number, including other names
2-Nitrobenzenesulfonyl Chloride, >95.0%(GC)(T) (CAS 1694-92-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | N0142-25G |
| cas | 1694-92-4 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 247.68 Pln | |
| TCI | 100g | 508.30 Pln | |
| TCI | 500g | 1398.32 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(GC)(T) |
2-nitrobenzenesulfonyl chloride (CAS 1694-92-4) is a chemical compound with the molecular formula C6H4ClNO4S and a molecular weight of 221.62 g/mol. IUPAC name: 2-nitrobenzenesulfonyl chloride. InChIKey: WPHUUIODWRNJLO-UHFFFAOYSA-N.
| Molecular formula | C6H4ClNO4S |
|---|---|
| Molecular weight | 221.62 g/mol |
| IUPAC name | 2-nitrobenzenesulfonyl chloride |
| InChIKey | WPHUUIODWRNJLO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])S(=O)(=O)Cl |
Computed by PubChem (NCBI)