2-Nitrobenzenesulfonyl chloride
cas: 1694-92-4 — see every product listed under this CAS number, including other names
2-Nitrobenzenesulfonyl chloride (CAS 1694-92-4) is a chemical reagent available from Chemat. Available pack sizes: 0,25kg, 0,5kg, 1kg, 2kg, 5kg, 5g, 25g, 100g. Offered by: Biosynth, Fluorochem.
| brand | Biosynth |
|---|---|
| catalog number | FN10727-0,25kg |
| cas | 1694-92-4 |
| size | 0,25kg |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Biosynth | 0,25kg | price on request | |
| Biosynth | 0,5kg | price on request | |
| Biosynth | 1kg | price on request | |
| Biosynth | 2kg | price on request | |
| Biosynth | 5kg | price on request | |
| Fluorochem | 5g | 159.34 Pln | |
| Fluorochem | 25g | 237.43 Pln | |
| Fluorochem | 100g | 456.11 Pln | |
| Fluorochem | 500g | 1393.28 Pln |
properties
| category | Research Chemicals |
|---|---|
| sub-category 1 | Building Blocks |
| sub-category 2 | Benzenes and Toluenes |
| purity | No data |
| delivery time | 1-2 weeks |
2-nitrobenzenesulfonyl chloride (CAS 1694-92-4) is a chemical compound with the molecular formula C6H4ClNO4S and a molecular weight of 221.62 g/mol. IUPAC name: 2-nitrobenzenesulfonyl chloride. InChIKey: WPHUUIODWRNJLO-UHFFFAOYSA-N.
| Molecular formula | C6H4ClNO4S |
|---|---|
| Molecular weight | 221.62 g/mol |
| IUPAC name | 2-nitrobenzenesulfonyl chloride |
| InChIKey | WPHUUIODWRNJLO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])S(=O)(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
2-Nitrobenzenesulfonyl chloride, o-Nitrophenylsulfonyl chloride, Benzenesulfonyl chloride, 2-nitro-, 2-Nitrobenzenesulphonyl chloride, Benzenesulfonyl chloride, o-nitro-, 2-nitrobenzene-1-sulfonyl chloride, o-Nitrobenzenesulfonyl chloride, 2-nitro-benzenesulfonyl chloride, Benzenesulfonyl chloride, nitro-, 2-nitrophenylsulfonyl chloride