cas: 33225-72-8 — see every product listed under this CAS number, including other names
2-Nitronicotinic acid (CAS 33225-72-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F044367-250MG |
| cas | 33225-72-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 138.51 Pln | |
| Fluorochem | 1g | 331.15 Pln | |
| Fluorochem | 5g | 1351.63 Pln | |
| Fluorochem | 25g | 4850.39 Pln |
| delivery time | 2-3 weeks |
|---|
2-nitropyridine-3-carboxylic acid (CAS 33225-72-8) is a chemical compound with the molecular formula C6H4N2O4 and a molecular weight of 168.11 g/mol. IUPAC name: 2-nitropyridine-3-carboxylic acid. InChIKey: RIMQELJEDBHDQZ-UHFFFAOYSA-N.
| Molecular formula | C6H4N2O4 |
|---|---|
| Molecular weight | 168.11 g/mol |
| IUPAC name | 2-nitropyridine-3-carboxylic acid |
| InChIKey | RIMQELJEDBHDQZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)