CAS 129116-97-8 appears in our catalog under these names: Pyridazine-3,4-dicarboxylic acid, 95%, Pyridazine-3,4-dicarboxylic acid, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg, 500mg.
Pyridazine-3,4-dicarboxylic acid (CAS 129116-97-8) is a chemical compound with the molecular formula C6H4N2O4 and a molecular weight of 168.11 g/mol. IUPAC name: pyridazine-3,4-dicarboxylic acid. InChIKey: RDQWJNPUOHXYCV-UHFFFAOYSA-N.
| Molecular formula | C6H4N2O4 |
|---|---|
| Molecular weight | 168.11 g/mol |
| IUPAC name | pyridazine-3,4-dicarboxylic acid |
| InChIKey | RDQWJNPUOHXYCV-UHFFFAOYSA-N |
| SMILES | C1=CN=NC(=C1C(=O)O)C(=O)O |
Computed by PubChem (NCBI)