CAS 4156-75-6 appears in our catalog under these names: Lactone-(5-hydroxymethyl)orotic acid, 95%, Lactone-(5-hydroxymethyl)orotic acid, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 25g.
1,5-dihydrofuro[3,4-d]pyrimidine-2,4,7-trione (CAS 4156-75-6) is a chemical compound with the molecular formula C6H4N2O4 and a molecular weight of 168.11 g/mol. IUPAC name: 1,5-dihydrofuro[3,4-d]pyrimidine-2,4,7-trione. InChIKey: MFHLWNMYHQMDMV-UHFFFAOYSA-N.
| Molecular formula | C6H4N2O4 |
|---|---|
| Molecular weight | 168.11 g/mol |
| IUPAC name | 1,5-dihydrofuro[3,4-d]pyrimidine-2,4,7-trione |
| InChIKey | MFHLWNMYHQMDMV-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=O)O1)NC(=O)NC2=O |
Computed by PubChem (NCBI)