Products 59290-82-3
CAS 59290-82-3 appears in our catalog under these names: 3-nitroisonicotinic acid, 95%, 3-Nitroisonicotinic Acid, ≥95%, 3–Nitropyridine–4–carboxylic acid, 3-Nitro-4-pyridinecarboxylic acid, 98%+(HPLC),RG, 3-Nitroisonicotinic acid, 98%+(HPLC),RG, 98%+(HPLC),RG. Offered by: Combi-blocks, Chemat, GLPBio, Fluorochem. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg.
3-nitropyridine-4-carboxylic acid (CAS 59290-82-3) is a chemical compound with the molecular formula C6H4N2O4 and a molecular weight of 168.11 g/mol. IUPAC name: 3-nitropyridine-4-carboxylic acid. InChIKey: YKPIUHZVTZWEEW-UHFFFAOYSA-N.
| Molecular formula | C6H4N2O4 |
|---|---|
| Molecular weight | 168.11 g/mol |
| IUPAC name | 3-nitropyridine-4-carboxylic acid |
| InChIKey | YKPIUHZVTZWEEW-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)