cas: 33225-73-9 — see every product listed under this CAS number, including other names
2-Nitropyridine-5-carboxylic acid, 96% (CAS 33225-73-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F076209-250MG |
| cas | 33225-73-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 5g | 440.49 Pln | |
| Fluorochem | 10g | 820.56 Pln | |
| Fluorochem | 25g | 1965.99 Pln | |
| Fluorochem | 100g | 6204.08 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
6-nitropyridine-3-carboxylic acid (CAS 33225-73-9) is a chemical compound with the molecular formula C6H4N2O4 and a molecular weight of 168.11 g/mol. IUPAC name: 6-nitropyridine-3-carboxylic acid. InChIKey: JHKLCZNDTUKHHI-UHFFFAOYSA-N.
| Molecular formula | C6H4N2O4 |
|---|---|
| Molecular weight | 168.11 g/mol |
| IUPAC name | 6-nitropyridine-3-carboxylic acid |
| InChIKey | JHKLCZNDTUKHHI-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)