cas: 1408075-00-2 — see every product listed under this CAS number, including other names
2-Oxa-6-azaspiro[3.4]octane oxalate 98% (CAS 1408075-00-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A329638-100mg |
| cas | 1408075-00-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 515.00 Pln | |
| Ambeed | 250mg | 648.50 Pln | |
| Ambeed | 1g | 1416.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A329638 |
2-oxa-7-azaspiro[3.4]octane;oxalic acid (CAS 1408075-00-2) is a chemical compound with the molecular formula C8H13NO5 and a molecular weight of 203.19 g/mol. IUPAC name: 2-oxa-7-azaspiro[3.4]octane;oxalic acid. InChIKey: BCXRHUMGWMWGLN-UHFFFAOYSA-N.
| Molecular formula | C8H13NO5 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 2-oxa-7-azaspiro[3.4]octane;oxalic acid |
| InChIKey | BCXRHUMGWMWGLN-UHFFFAOYSA-N |
| SMILES | C1CNCC12COC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)