cas: 105404-33-9 — see every product listed under this CAS number, including other names
2-Oxo-1,2,3,4-tetrahydroquinoline-3-carboxylic acid methyl ester, 97%, 97% (CAS 105404-33-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1106RQ-100mg |
| cas | 105404-33-9 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 506.00 Pln | |
| Chemat | 250mg | 784.40 Pln | |
| Chemat | 1g | 1782.80 Pln | |
| Chemat | 5g | 5368.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate (CAS 105404-33-9) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: methyl 2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate. InChIKey: JDKYMNFPRFYLKN-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | methyl 2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate |
| InChIKey | JDKYMNFPRFYLKN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC2=CC=CC=C2NC1=O |
Computed by PubChem (NCBI)