cas: 108284-94-2 — see every product listed under this CAS number, including other names
2-Oxo-1,2,3,4-tetrahydroquinoline-6-carbaldehyde 95+% (CAS 108284-94-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A174771-100mg |
| cas | 108284-94-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 2511.94 Pln | |
| Ambeed | 250mg | 3557.69 Pln | |
| Ambeed | 1g | 7106.56 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A174771 |
2-oxo-3,4-dihydro-1H-quinoline-6-carbaldehyde (CAS 108284-94-2) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: 2-oxo-3,4-dihydro-1H-quinoline-6-carbaldehyde. InChIKey: COASPZBJWCIUAT-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 2-oxo-3,4-dihydro-1H-quinoline-6-carbaldehyde |
| InChIKey | COASPZBJWCIUAT-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC2=C1C=C(C=C2)C=O |
Computed by PubChem (NCBI)