cas: 70639-78-0 — see every product listed under this CAS number, including other names
2-Oxo-1,2-dihydroquinoline-6-carboxylic acid 95% (CAS 70639-78-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A167125-100mg |
| cas | 70639-78-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 353.69 Pln | |
| Ambeed | 250mg | 770.88 Pln | |
| Ambeed | 1g | 2873.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A167125 |
2-oxo-1H-quinoline-6-carboxylic acid (CAS 70639-78-0) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 2-oxo-1H-quinoline-6-carboxylic acid. InChIKey: ZEGJLQZSCUPAPR-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 2-oxo-1H-quinoline-6-carboxylic acid |
| InChIKey | ZEGJLQZSCUPAPR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=O)N2)C=C1C(=O)O |
Computed by PubChem (NCBI)