cas: 500-72-1 — see every product listed under this CAS number, including other names
2-Oxo-2-(phenylamino)acetic acid, 98%, 98% (CAS 500-72-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DCMJ-100mg |
| cas | 500-72-1 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 227.60 Pln | |
| Chemat | 5g | 568.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-anilino-2-oxoacetic acid (CAS 500-72-1) is a chemical compound with the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. IUPAC name: 2-anilino-2-oxoacetic acid. InChIKey: PQJZHMCWDKOPQG-UHFFFAOYSA-N.
| Molecular formula | C8H7NO3 |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | 2-anilino-2-oxoacetic acid |
| InChIKey | PQJZHMCWDKOPQG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)C(=O)O |
Computed by PubChem (NCBI)