CAS 3179-08-6 appears in our catalog under these names: 4-Hydroxy-beta-nitrostyrene, 96%, 4–(2–Nitrovinyl)phenol, 4-(2-Nitrovinyl)phenol 97%, 4-(2-Nitrovinyl)Phenol, 98%, 98%, 4-Hydroxy-b-nitrostyrene, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 100g, 25g, 10g, 1g, 250mg.
4-[(E)-2-nitroethenyl]phenol (CAS 3179-08-6) is a chemical compound with the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. IUPAC name: 4-[(E)-2-nitroethenyl]phenol. InChIKey: CTJKRKMPTRJAIT-AATRIKPKSA-N.
| Molecular formula | C8H7NO3 |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | 4-[(E)-2-nitroethenyl]phenol |
| InChIKey | CTJKRKMPTRJAIT-AATRIKPKSA-N |
| SMILES | C1=CC(=CC=C1/C=C/[N+](=O)[O-])O |
Computed by PubChem (NCBI)