CAS 80709-80-4 appears in our catalog under these names: 2-Methyl-4h-furo[3,2-b]pyrrole-5-carboxylic acid, 95%, 2-Methyl-4h-furo(3,2-b)pyrrole-5-carboxylic Acid, 2-Methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid 95%, 2-Methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 750mg, 0,5g, 100mg.
2-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid (CAS 80709-80-4) is a chemical compound with the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. IUPAC name: 2-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid. InChIKey: ILLLWINWDFYWES-UHFFFAOYSA-N.
| Molecular formula | C8H7NO3 |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | 2-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid |
| InChIKey | ILLLWINWDFYWES-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(O1)C=C(N2)C(=O)O |
Computed by PubChem (NCBI)