Products 3477-93-8

CAS 3477-93-8 is the registry number for 4-[(Hydroxyimino)methyl]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g.

Structural formula: {0} (CAS {1})

4-(hydroxyiminomethyl)benzoic acid (CAS 3477-93-8) is a chemical compound with the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. IUPAC name: 4-(hydroxyiminomethyl)benzoic acid. InChIKey: UYCPLAQBBAOCGQ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7NO3
Molecular weight165.15 g/mol
IUPAC name4-(hydroxyiminomethyl)benzoic acid
InChIKeyUYCPLAQBBAOCGQ-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C=NO)C(=O)O

Computed by PubChem (NCBI)