cas: 43038-37-5 — see every product listed under this CAS number, including other names
2-Phenoxybenzohydrazide, >98.0%(GC)(T) (CAS 43038-37-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | P2357-1G |
| cas | 43038-37-5 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 172.43 Pln | |
| TCI | 5g | 639.57 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
2-phenoxybenzohydrazide (CAS 43038-37-5) is a chemical compound with the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. IUPAC name: 2-phenoxybenzohydrazide. InChIKey: PIMAJOVNMMNVCZ-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O2 |
|---|---|
| Molecular weight | 228.25 g/mol |
| IUPAC name | 2-phenoxybenzohydrazide |
| InChIKey | PIMAJOVNMMNVCZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC=C2C(=O)NN |
Computed by PubChem (NCBI)