cas: 43038-37-5 — see every product listed under this CAS number, including other names
2-Phenoxybenzohydrazide, 98%, 98% (CAS 43038-37-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DCNJ-1g |
| cas | 43038-37-5 |
| size | 1g |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 179.60 Pln | |
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 131.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-phenoxybenzohydrazide (CAS 43038-37-5) is a chemical compound with the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. IUPAC name: 2-phenoxybenzohydrazide. InChIKey: PIMAJOVNMMNVCZ-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O2 |
|---|---|
| Molecular weight | 228.25 g/mol |
| IUPAC name | 2-phenoxybenzohydrazide |
| InChIKey | PIMAJOVNMMNVCZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC=C2C(=O)NN |
Computed by PubChem (NCBI)