Products 43038-37-5
CAS 43038-37-5 appears in our catalog under these names: 2-Phenoxybenzhydrazide, 95%, 2-Phenoxybenzoic acid hydrazide, 2-Phenoxybenzohydrazide, >98.0%(GC)(T), 2-Phenoxybenzohydrazide, 98%, 98%, 2-Phenoxybenzoic acid hydrazide, min. 95 %, 50 g. Offered by: Combi-blocks, Biosynth, TCI, Chemat, Roth. Available pack sizes: 25g, 1g, 5g, 50g, 100mg, 250mg.
2-phenoxybenzohydrazide (CAS 43038-37-5) is a chemical compound with the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. IUPAC name: 2-phenoxybenzohydrazide. InChIKey: PIMAJOVNMMNVCZ-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O2 |
|---|---|
| Molecular weight | 228.25 g/mol |
| IUPAC name | 2-phenoxybenzohydrazide |
| InChIKey | PIMAJOVNMMNVCZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC=C2C(=O)NN |
Computed by PubChem (NCBI)