cas: 81249-44-7 — see every product listed under this CAS number, including other names
2-Phenoxyisonicotinonitrile (CAS 81249-44-7) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120MRM-1g |
| cas | 81249-44-7 |
| size | 1g |
| availability | 13.51g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2795.60 Pln |
| delivery time | 3 weeks |
|---|
2-phenoxypyridine-4-carbonitrile (CAS 81249-44-7) is a chemical compound with the molecular formula C12H8N2O and a molecular weight of 196.20 g/mol. IUPAC name: 2-phenoxypyridine-4-carbonitrile. InChIKey: CRIVCEBEXJZQRH-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 2-phenoxypyridine-4-carbonitrile |
| InChIKey | CRIVCEBEXJZQRH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=NC=CC(=C2)C#N |
Computed by PubChem (NCBI)