cas: 21203-83-8 — see every product listed under this CAS number, including other names
2-Phenoxypyridin-4-amine, 95%, 95% (CAS 21203-83-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CB5Q-100mg |
| cas | 21203-83-8 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 246.80 Pln | |
| Chemat | 250mg | 424.40 Pln | |
| Chemat | 1g | 976.40 Pln | |
| Chemat | 5g | 2800.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-phenoxypyridin-4-amine (CAS 21203-83-8) is a chemical compound with the molecular formula C11H10N2O and a molecular weight of 186.21 g/mol. IUPAC name: 2-phenoxypyridin-4-amine. InChIKey: OFTDZLLFZKPIIT-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 2-phenoxypyridin-4-amine |
| InChIKey | OFTDZLLFZKPIIT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=NC=CC(=C2)N |
Computed by PubChem (NCBI)