cas: 849020-81-1 — see every product listed under this CAS number, including other names
2-Phenyl-1,6-naphthyridine-3-carboxylic acid (CAS 849020-81-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F023364-100MG |
| cas | 849020-81-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 612.30 Pln | |
| Fluorochem | 1g | 3949.67 Pln |
| delivery time | 2-3 weeks |
|---|
2-phenyl-1,6-naphthyridine-3-carboxylic acid (CAS 849020-81-1) is a chemical compound with the molecular formula C15H10N2O2 and a molecular weight of 250.25 g/mol. IUPAC name: 2-phenyl-1,6-naphthyridine-3-carboxylic acid. InChIKey: JIFDGHZNEPJPIG-UHFFFAOYSA-N.
| Molecular formula | C15H10N2O2 |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | 2-phenyl-1,6-naphthyridine-3-carboxylic acid |
| InChIKey | JIFDGHZNEPJPIG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=C3C=NC=CC3=N2)C(=O)O |
Computed by PubChem (NCBI)