cas: 41373-37-9 — see every product listed under this CAS number, including other names
2-Phenylbenzo[d]oxazol-5-amine 98% (CAS 41373-37-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A976587-250mg |
| cas | 41373-37-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 464.94 Pln | |
| Ambeed | 1g | 776.44 Pln | |
| Ambeed | 5g | 2951.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A976587 |
2-phenyl-1,3-benzoxazol-5-amine (CAS 41373-37-9) is a chemical compound with the molecular formula C13H10N2O and a molecular weight of 210.23 g/mol. IUPAC name: 2-phenyl-1,3-benzoxazol-5-amine. InChIKey: SUOXXPHZWVBJSY-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 2-phenyl-1,3-benzoxazol-5-amine |
| InChIKey | SUOXXPHZWVBJSY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(O2)C=CC(=C3)N |
Computed by PubChem (NCBI)