CAS 100382-00-1 appears in our catalog under these names: 4-(Benzyloxy)picolinonitrile, 98%, 4-(Benzyloxy)picolinonitrile 98%, 4-(Benzyloxy)picolinonitrile, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg.
4-phenylmethoxypyridine-2-carbonitrile (CAS 100382-00-1) is a chemical compound with the molecular formula C13H10N2O and a molecular weight of 210.23 g/mol. IUPAC name: 4-phenylmethoxypyridine-2-carbonitrile. InChIKey: KHDORVLVNIOXJY-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 4-phenylmethoxypyridine-2-carbonitrile |
| InChIKey | KHDORVLVNIOXJY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=NC=C2)C#N |
Computed by PubChem (NCBI)