CAS 2915-84-6 appears in our catalog under these names: 2,7-Diamino-9-fluorenone, 97%, 2,7-Diamino-9H-Fluoren-9-One, 97%, 97%, 2,7-Diamino-9H-fluoren-9-one, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 1g, 100mg, 250mg, 10g.
2,7-diaminofluoren-9-one (CAS 2915-84-6) is a chemical compound with the molecular formula C13H10N2O and a molecular weight of 210.23 g/mol. IUPAC name: 2,7-diaminofluoren-9-one. InChIKey: GWTJRFCUTIHVPX-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 2,7-diaminofluoren-9-one |
| InChIKey | GWTJRFCUTIHVPX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)C(=O)C3=C2C=CC(=C3)N |
Computed by PubChem (NCBI)