Products 1423037-18-6
CAS 1423037-18-6 is the registry number for 3-[4-(Hydroxymethyl)phenyl]pyridine-2-carbonitrile, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-[4-(hydroxymethyl)phenyl]pyridine-2-carbonitrile (CAS 1423037-18-6) is a chemical compound with the molecular formula C13H10N2O and a molecular weight of 210.23 g/mol. IUPAC name: 3-[4-(hydroxymethyl)phenyl]pyridine-2-carbonitrile. InChIKey: KOZHHPNPJLOFKM-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 3-[4-(hydroxymethyl)phenyl]pyridine-2-carbonitrile |
| InChIKey | KOZHHPNPJLOFKM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)C#N)C2=CC=C(C=C2)CO |
Computed by PubChem (NCBI)