cas: 41373-37-9 — see every product listed under this CAS number, including other names
2-Phenylbenzooxazol-5-ylamine (CAS 41373-37-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F015509-250MG |
| cas | 41373-37-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 482.14 Pln | |
| Fluorochem | 1g | 1231.88 Pln |
| delivery time | 2-3 weeks |
|---|
2-phenyl-1,3-benzoxazol-5-amine (CAS 41373-37-9) is a chemical compound with the molecular formula C13H10N2O and a molecular weight of 210.23 g/mol. IUPAC name: 2-phenyl-1,3-benzoxazol-5-amine. InChIKey: SUOXXPHZWVBJSY-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 2-phenyl-1,3-benzoxazol-5-amine |
| InChIKey | SUOXXPHZWVBJSY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(O2)C=CC(=C3)N |
Computed by PubChem (NCBI)