cas: 19853-09-9 — see every product listed under this CAS number, including other names
2-Phenylbenzyl bromide, 97% (CAS 19853-09-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F099422-100MG |
| cas | 19853-09-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 133.30 Pln | |
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 1g | 247.85 Pln | |
| Fluorochem | 5g | 596.68 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
1-(bromomethyl)-2-phenylbenzene (CAS 19853-09-9) is a chemical compound with the molecular formula C13H11Br and a molecular weight of 247.13 g/mol. IUPAC name: 1-(bromomethyl)-2-phenylbenzene. InChIKey: SEXZHJJUKFXNDY-UHFFFAOYSA-N.
| Molecular formula | C13H11Br |
|---|---|
| Molecular weight | 247.13 g/mol |
| IUPAC name | 1-(bromomethyl)-2-phenylbenzene |
| InChIKey | SEXZHJJUKFXNDY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2CBr |
Computed by PubChem (NCBI)