CAS 127971-24-8 is the registry number for 1-Bromo-4-cyclopropylnaphthalene, 97%. Offered by: AmBeed. Available pack sizes: 5g.
1-bromo-4-cyclopropylnaphthalene (CAS 127971-24-8) is a chemical compound with the molecular formula C13H11Br and a molecular weight of 247.13 g/mol. IUPAC name: 1-bromo-4-cyclopropylnaphthalene. InChIKey: GXWZSHOVWDCGQD-UHFFFAOYSA-N.
| Molecular formula | C13H11Br |
|---|---|
| Molecular weight | 247.13 g/mol |
| IUPAC name | 1-bromo-4-cyclopropylnaphthalene |
| InChIKey | GXWZSHOVWDCGQD-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC=C(C3=CC=CC=C23)Br |
Computed by PubChem (NCBI)