cas: 89185-48-8 — see every product listed under this CAS number, including other names
2-Phenylimidazo(1,2-a)pyrimidin-3-amine, 97% (CAS 89185-48-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A995347-5g |
| cas | 89185-48-8 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 11410.42 Pln | |
| AmBeed | 10g | 15980.44 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-phenylimidazo[1,2-a]pyrimidin-3-amine (CAS 89185-48-8) is a chemical compound with the molecular formula C12H10N4 and a molecular weight of 210.23 g/mol. IUPAC name: 2-phenylimidazo[1,2-a]pyrimidin-3-amine. InChIKey: FOJZDMGNAKIZQC-UHFFFAOYSA-N.
| Molecular formula | C12H10N4 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 2-phenylimidazo[1,2-a]pyrimidin-3-amine |
| InChIKey | FOJZDMGNAKIZQC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N3C=CC=NC3=N2)N |
Computed by PubChem (NCBI)