Products 289628-76-8
CAS 289628-76-8 is the registry number for 4-(1H-Indol-3-yl)pyrimidin-2-amine, 97%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-(1H-indol-3-yl)pyrimidin-2-amine (CAS 289628-76-8) is a chemical compound with the molecular formula C12H10N4 and a molecular weight of 210.23 g/mol. IUPAC name: 4-(1H-indol-3-yl)pyrimidin-2-amine. InChIKey: QNMZWFNNJMGJPU-UHFFFAOYSA-N.
| Molecular formula | C12H10N4 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 4-(1H-indol-3-yl)pyrimidin-2-amine |
| InChIKey | QNMZWFNNJMGJPU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C3=NC(=NC=C3)N |
Computed by PubChem (NCBI)