Products 2007916-18-7
CAS 2007916-18-7 is the registry number for 5-(4-Methylpyridin-3-yl)-1h-pyrazolo[3,4-c]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-(4-methyl-3-pyridinyl)-1H-pyrazolo[3,4-c]pyridine (CAS 2007916-18-7) is a chemical compound with the molecular formula C12H10N4 and a molecular weight of 210.23 g/mol. IUPAC name: 5-(4-methyl-3-pyridinyl)-1H-pyrazolo[3,4-c]pyridine. InChIKey: FXBVYFIBJIVLHT-UHFFFAOYSA-N.
| Molecular formula | C12H10N4 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 5-(4-methyl-3-pyridinyl)-1H-pyrazolo[3,4-c]pyridine |
| InChIKey | FXBVYFIBJIVLHT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NC=C1)C2=NC=C3C(=C2)C=NN3 |
Computed by PubChem (NCBI)