CAS 52217-39-7 appears in our catalog under these names: 3-Methyl-1-phenyl-1h-pyrazolo[3,4-d]pyrimidine, 95%, 3-Methyl-1-phenyl-1H-pyrazolo(3,4-d)pyrimidine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
3-methyl-1-phenylpyrazolo[3,4-d]pyrimidine (CAS 52217-39-7) is a chemical compound with the molecular formula C12H10N4 and a molecular weight of 210.23 g/mol. IUPAC name: 3-methyl-1-phenylpyrazolo[3,4-d]pyrimidine. InChIKey: BTTKVIVWBIPDIH-UHFFFAOYSA-N.
| Molecular formula | C12H10N4 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 3-methyl-1-phenylpyrazolo[3,4-d]pyrimidine |
| InChIKey | BTTKVIVWBIPDIH-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=NC=NC=C12)C3=CC=CC=C3 |
Computed by PubChem (NCBI)