cas: 6266-49-5 — see every product listed under this CAS number, including other names
2-Phenylphthalazin-1(2H)-one 97% (CAS 6266-49-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1003768-100mg |
| cas | 6266-49-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 464.94 Pln | |
| Ambeed | 250mg | 565.06 Pln | |
| Ambeed | 1g | 1010.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1003768 |
2-phenylphthalazin-1-one (CAS 6266-49-5) is a chemical compound with the molecular formula C14H10N2O and a molecular weight of 222.24 g/mol. IUPAC name: 2-phenylphthalazin-1-one. InChIKey: BCCBXCGRKOKWBZ-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 2-phenylphthalazin-1-one |
| InChIKey | BCCBXCGRKOKWBZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C3=CC=CC=C3C=N2 |
Computed by PubChem (NCBI)