CAS 82326-53-2 appears in our catalog under these names: 5-Benzoyl-1H-1,3-benzodiazole, 95%, (1H-Benzo(d)imidazol-5-yl)(phenyl)methanone, 95+%, 5-Benzoyl-1H-1,3-benzodiazole. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg, 2mg, 10mg.
3H-benzimidazol-5-yl(phenyl)methanone (CAS 82326-53-2) is a chemical compound with the molecular formula C14H10N2O and a molecular weight of 222.24 g/mol. IUPAC name: 3H-benzimidazol-5-yl(phenyl)methanone. InChIKey: CGVCBANYMPJILL-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 3H-benzimidazol-5-yl(phenyl)methanone |
| InChIKey | CGVCBANYMPJILL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC3=C(C=C2)N=CN3 |
Computed by PubChem (NCBI)