CAS 446830-54-2 is the registry number for 3-Phenyl-imidazo[1,5-a]pyridine-1-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
3-phenylimidazo[1,5-a]pyridine-1-carbaldehyde (CAS 446830-54-2) is a chemical compound with the molecular formula C14H10N2O and a molecular weight of 222.24 g/mol. IUPAC name: 3-phenylimidazo[1,5-a]pyridine-1-carbaldehyde. InChIKey: JWNWWOLANIRMII-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 3-phenylimidazo[1,5-a]pyridine-1-carbaldehyde |
| InChIKey | JWNWWOLANIRMII-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=C3N2C=CC=C3)C=O |
Computed by PubChem (NCBI)