CAS 888-71-1 appears in our catalog under these names: 3,5-Diphenyl-1,2,4-oxadiazole, 95%, 3,5-Diphenyl-1,2,4-oxadiazole, 3,5-Diphenyl-1,2,4-oxadiazole, 97%, 97%, 3,5-Diphenyl-[1,2,4]oxadiazole, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 5g, 250mg, 2,5g, 500mg.
3,5-diphenyl-1,2,4-oxadiazole (CAS 888-71-1) is a chemical compound with the molecular formula C14H10N2O and a molecular weight of 222.24 g/mol. IUPAC name: 3,5-diphenyl-1,2,4-oxadiazole. InChIKey: VIZNDSYPXQJMCM-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 3,5-diphenyl-1,2,4-oxadiazole |
| InChIKey | VIZNDSYPXQJMCM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NOC(=N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)