cas: 122773-97-1 — see every product listed under this CAS number, including other names
2-Phenylpyrimidine-5-carboxylic acid, 97% (CAS 122773-97-1) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g, 5g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC66301CB |
| cas | 122773-97-1 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 360.94 Pln | |
| Thermo Scientific | 1g | 967.25 Pln | |
| Thermo Scientific | 5g | 2687.94 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
2-phenylpyrimidine-5-carboxylic acid (CAS 122773-97-1) is a chemical compound with the molecular formula C11H8N2O2 and a molecular weight of 200.19 g/mol. IUPAC name: 2-phenylpyrimidine-5-carboxylic acid. InChIKey: BOAIYSRFGWBZCF-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O2 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | 2-phenylpyrimidine-5-carboxylic acid |
| InChIKey | BOAIYSRFGWBZCF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=C(C=N2)C(=O)O |
Computed by PubChem (NCBI)