cas: 122773-97-1 — see every product listed under this CAS number, including other names
2-Phenylpyrimidine-5-carboxylic acid, 98% (CAS 122773-97-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F216928-250MG |
| cas | 122773-97-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 456.11 Pln | |
| Fluorochem | 1g | 872.63 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-phenylpyrimidine-5-carboxylic acid (CAS 122773-97-1) is a chemical compound with the molecular formula C11H8N2O2 and a molecular weight of 200.19 g/mol. IUPAC name: 2-phenylpyrimidine-5-carboxylic acid. InChIKey: BOAIYSRFGWBZCF-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O2 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | 2-phenylpyrimidine-5-carboxylic acid |
| InChIKey | BOAIYSRFGWBZCF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=C(C=N2)C(=O)O |
Computed by PubChem (NCBI)