cas: 1022-44-2 — see every product listed under this CAS number, including other names
2-Phenylquinazolin-4-amine, 95%+, 95%+ (CAS 1022-44-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1117W6-100mg |
| cas | 1022-44-2 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 611.60 Pln | |
| Chemat | 250mg | 1163.60 Pln | |
| Chemat | 1g | 3371.60 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
2-phenylquinazolin-4-amine (CAS 1022-44-2) is a chemical compound with the molecular formula C14H11N3 and a molecular weight of 221.26 g/mol. IUPAC name: 2-phenylquinazolin-4-amine. InChIKey: AEEMTZOWFJHGNW-UHFFFAOYSA-N.
| Molecular formula | C14H11N3 |
|---|---|
| Molecular weight | 221.26 g/mol |
| IUPAC name | 2-phenylquinazolin-4-amine |
| InChIKey | AEEMTZOWFJHGNW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=CC=CC=C3C(=N2)N |
Computed by PubChem (NCBI)