CAS 2022939-96-2 is the registry number for 5-(Pyridin-3-yl)quinolin-8-amine. Offered by: Biosynth. Available pack sizes: 50mg, 100mg, 250mg, 1000mg, 500mg.
5-pyridin-3-ylquinolin-8-amine (CAS 2022939-96-2) is a chemical compound with the molecular formula C14H11N3 and a molecular weight of 221.26 g/mol. IUPAC name: 5-pyridin-3-ylquinolin-8-amine. InChIKey: LCWYPXZSHYPNMI-UHFFFAOYSA-N.
| Molecular formula | C14H11N3 |
|---|---|
| Molecular weight | 221.26 g/mol |
| IUPAC name | 5-pyridin-3-ylquinolin-8-amine |
| InChIKey | LCWYPXZSHYPNMI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=C3C=CC=NC3=C(C=C2)N |
Computed by PubChem (NCBI)